Synonyms: N-(3-chloro-1H-indol-7-yl)-4-sulfamoylbenzenesulfonamide; N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide
Molecular Formula: C14H12ClN3O4S2
Molecular Weight: 385.85
Linear Structural Formula: C14H12ClN3O4S2
MDL Number: MFCD00945325
Purity: >=98% (HPLC)
Storage: -20C
Biochem Physiol Actions: Indisulam is synthetic sulfonamide compound. In vitro and in vivo studies point out that indisulam prevents retinoblastoma protein phosphorylation. Also, it inhibits cyclins A and B1 activity. Indisulam is known to promote apoptosis. Indisulam is a potent inhibitor of cellular dehydrogenases and thus, is likely to interfere with metabolic pathways such as malate-aspartate shuttle, glycolysis and gluconeogenesis.